Benzene and substituted derivatives
Filtered Search Results
2-Chloro-6-fluorobenzylideneacetone, 98%
CAS: 175136-82-0 Molecular Formula: C10H8ClFO Molecular Weight (g/mol): 198.621 MDL Number: MFCD00051608 InChI Key: VZRBDBXFAKDNDJ-AATRIKPKSA-N Synonym: 2-chloro-6-fluorobenzylideneacetone,3e-4-2-chloro-6-fluorophenyl but-3-en-2-one,4-2-chloro-6-fluorophenyl but-3-en-2-one,1-2-chloro-6-fluorophenyl but-1-en-3-one,e-4-2-chloro-6-fluoro-phenyl but-3-en-2-one,labotest-bb lt00455271,1-2-chloro-6-fluorophenyl-1-buten-2-one,e-4-2-chloro-6-fluorophenyl-3-buten-2-one,e-4-2-chloro-6-fluorophenyl but-3-en-2-one PubChem CID: 5373895 IUPAC Name: (E)-4-(2-chloro-6-fluorophenyl)but-3-en-2-one SMILES: CC(=O)C=CC1=C(C=CC=C1Cl)F
| PubChem CID | 5373895 |
|---|---|
| CAS | 175136-82-0 |
| Molecular Weight (g/mol) | 198.621 |
| MDL Number | MFCD00051608 |
| SMILES | CC(=O)C=CC1=C(C=CC=C1Cl)F |
| Synonym | 2-chloro-6-fluorobenzylideneacetone,3e-4-2-chloro-6-fluorophenyl but-3-en-2-one,4-2-chloro-6-fluorophenyl but-3-en-2-one,1-2-chloro-6-fluorophenyl but-1-en-3-one,e-4-2-chloro-6-fluoro-phenyl but-3-en-2-one,labotest-bb lt00455271,1-2-chloro-6-fluorophenyl-1-buten-2-one,e-4-2-chloro-6-fluorophenyl-3-buten-2-one,e-4-2-chloro-6-fluorophenyl but-3-en-2-one |
| IUPAC Name | (E)-4-(2-chloro-6-fluorophenyl)but-3-en-2-one |
| InChI Key | VZRBDBXFAKDNDJ-AATRIKPKSA-N |
| Molecular Formula | C10H8ClFO |
3-Vinylbenzoic acid, 96%
CAS: 28447-20-3 Molecular Formula: C9H8O2 Molecular Weight (g/mol): 148.161 MDL Number: MFCD00157038 InChI Key: VWXZFDWVWMQRQR-UHFFFAOYSA-N PubChem CID: 4438231 IUPAC Name: 3-ethenylbenzoic acid SMILES: C=CC1=CC(=CC=C1)C(=O)O
| PubChem CID | 4438231 |
|---|---|
| CAS | 28447-20-3 |
| Molecular Weight (g/mol) | 148.161 |
| MDL Number | MFCD00157038 |
| SMILES | C=CC1=CC(=CC=C1)C(=O)O |
| IUPAC Name | 3-ethenylbenzoic acid |
| InChI Key | VWXZFDWVWMQRQR-UHFFFAOYSA-N |
| Molecular Formula | C9H8O2 |
Poly(styrene sulfonic acid), M.W. 75,000, 30% w/v aq. soln.
CAS: 28210-41-5 MDL Number: MFCD00165973 Synonym: 4-styrenesulfonic acid,polystyrene sulfonate,tolevamer,styrene-4-sulphonic acid,4-vinylbenzenesulfonic acid,benzenesulfonic acid, 4-ethenyl,poly 4-vinylbenzenesulfonic acid,tolevamer inn,poly styrene sulfonic acid sodium salt,unii-zsl2fb6gxn
| CAS | 28210-41-5 |
|---|---|
| MDL Number | MFCD00165973 |
| Synonym | 4-styrenesulfonic acid,polystyrene sulfonate,tolevamer,styrene-4-sulphonic acid,4-vinylbenzenesulfonic acid,benzenesulfonic acid, 4-ethenyl,poly 4-vinylbenzenesulfonic acid,tolevamer inn,poly styrene sulfonic acid sodium salt,unii-zsl2fb6gxn |
2-Methoxybenzonitrile, 98%
CAS: 6609-56-9 Molecular Formula: C8H7NO Molecular Weight (g/mol): 133.15 MDL Number: MFCD00001783 InChI Key: FSTPMFASNVISBU-UHFFFAOYSA-N Synonym: 2-cyanoanisole,o-methoxybenzonitrile,2-methoxy-benzonitrile,benzonitrile, 2-methoxy,2-methoxybenzenecarbonitrile,o-anisolnitrile,o-anisonitrile,methoxybenzonitrile,2-methxybenzonitrile,o-methyoxybenzonitrile PubChem CID: 81086 IUPAC Name: 2-methoxybenzonitrile SMILES: COC1=CC=CC=C1C#N
| PubChem CID | 81086 |
|---|---|
| CAS | 6609-56-9 |
| Molecular Weight (g/mol) | 133.15 |
| MDL Number | MFCD00001783 |
| SMILES | COC1=CC=CC=C1C#N |
| Synonym | 2-cyanoanisole,o-methoxybenzonitrile,2-methoxy-benzonitrile,benzonitrile, 2-methoxy,2-methoxybenzenecarbonitrile,o-anisolnitrile,o-anisonitrile,methoxybenzonitrile,2-methxybenzonitrile,o-methyoxybenzonitrile |
| IUPAC Name | 2-methoxybenzonitrile |
| InChI Key | FSTPMFASNVISBU-UHFFFAOYSA-N |
| Molecular Formula | C8H7NO |
2,3-Dichloroanisole, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 1984-59-4
| CAS | 1984-59-4 |
|---|
4-Fluoro-2-methoxybenzonitrile, 97%
CAS: 191014-55-8 Molecular Formula: C8H6FNO Molecular Weight (g/mol): 151.14 MDL Number: MFCD04116335 InChI Key: HGBKZVIQHCUHRI-UHFFFAOYSA-N Synonym: benzonitrile, 4-fluoro-2-methoxy,2-methoxy-4-fluorobenzonitrile,4-fluoro-2-methoxy-benzonitrile,benzonitrile, 4-fluoro-2-methoxy-9ci,4-fluoro-2-methoxybenzenecarbonitrile,pubchem4786,acmc-209xzr,ksc494i6t,4fluoro-2-methoxy-benzonitrile,buttpark 80\07-22 PubChem CID: 2783329 IUPAC Name: 4-fluoro-2-methoxybenzonitrile SMILES: COC1=C(C=CC(=C1)F)C#N
| PubChem CID | 2783329 |
|---|---|
| CAS | 191014-55-8 |
| Molecular Weight (g/mol) | 151.14 |
| MDL Number | MFCD04116335 |
| SMILES | COC1=C(C=CC(=C1)F)C#N |
| Synonym | benzonitrile, 4-fluoro-2-methoxy,2-methoxy-4-fluorobenzonitrile,4-fluoro-2-methoxy-benzonitrile,benzonitrile, 4-fluoro-2-methoxy-9ci,4-fluoro-2-methoxybenzenecarbonitrile,pubchem4786,acmc-209xzr,ksc494i6t,4fluoro-2-methoxy-benzonitrile,buttpark 80\07-22 |
| IUPAC Name | 4-fluoro-2-methoxybenzonitrile |
| InChI Key | HGBKZVIQHCUHRI-UHFFFAOYSA-N |
| Molecular Formula | C8H6FNO |
4-Bromoanisole, 98%
CAS: 104-92-7 Molecular Formula: C7H7BrO Molecular Weight (g/mol): 187.04 MDL Number: MFCD00000097 InChI Key: QJPJQTDYNZXKQF-UHFFFAOYSA-N Synonym: 4-bromoanisole,p-bromoanisole,benzene, 1-bromo-4-methoxy,4-methoxybromobenzene,anisyl bromide,p-anisyl bromide,p-bromanisole,p-methoxybromobenzene,p-methoxyphenyl bromide,4-methoxyphenyl bromide PubChem CID: 7730 ChEBI: CHEBI:47257 IUPAC Name: 1-bromo-4-methoxybenzene SMILES: COC1=CC=C(C=C1)Br
| PubChem CID | 7730 |
|---|---|
| CAS | 104-92-7 |
| Molecular Weight (g/mol) | 187.04 |
| ChEBI | CHEBI:47257 |
| MDL Number | MFCD00000097 |
| SMILES | COC1=CC=C(C=C1)Br |
| Synonym | 4-bromoanisole,p-bromoanisole,benzene, 1-bromo-4-methoxy,4-methoxybromobenzene,anisyl bromide,p-anisyl bromide,p-bromanisole,p-methoxybromobenzene,p-methoxyphenyl bromide,4-methoxyphenyl bromide |
| IUPAC Name | 1-bromo-4-methoxybenzene |
| InChI Key | QJPJQTDYNZXKQF-UHFFFAOYSA-N |
| Molecular Formula | C7H7BrO |
Hippuric Acid Analytical Standard, MilliporeSigma™ Supelco™
Hippuric acid, the glycine conjugate of benzoic acid, is formed via a biotransformation process. From scientific literature, it is reported to be found as an excretory product in urine. Hippuric acid is also known to be catabolically synthesized from benzene-type aromatic compounds.
| Percent Purity | ≥97.5% (GC) |
|---|---|
| CAS | 495-69-2 |
| MDL Number | MFCD00002692 |
| UN Number | NONH for all modes of transport |
| Synonym | N-Benzoylglycine; Benzoylaminoacetic Acid |
| RTECS Number | MR8150000 |
| Grade | Analytical Standard |
| Shelf Life | Limited shelf life, expiry date on the label |
| Molecular Formula | C9H9NO3 |
| Formula Weight | 179.17 |
| Melting Point | 187°C to 191°C (literature) |
Anthranilamide, 99+%
CAS: 88-68-6 Molecular Formula: C7H8N2O Molecular Weight (g/mol): 136.15 MDL Number: MFCD00007981 InChI Key: PXBFMLJZNCDSMP-UHFFFAOYSA-N Synonym: anthranilamide,benzamide, 2-amino,o-aminobenzamide,2-carbamoylaniline,aminobenzamide,anthranilimidic acid,benzamide, o-amino,anthranilic acid amide,anthranilamide van,o-aminobenzamide van PubChem CID: 6942 IUPAC Name: 2-aminobenzamide SMILES: C1=CC=C(C(=C1)C(=O)N)N
| PubChem CID | 6942 |
|---|---|
| CAS | 88-68-6 |
| Molecular Weight (g/mol) | 136.15 |
| MDL Number | MFCD00007981 |
| SMILES | C1=CC=C(C(=C1)C(=O)N)N |
| Synonym | anthranilamide,benzamide, 2-amino,o-aminobenzamide,2-carbamoylaniline,aminobenzamide,anthranilimidic acid,benzamide, o-amino,anthranilic acid amide,anthranilamide van,o-aminobenzamide van |
| IUPAC Name | 2-aminobenzamide |
| InChI Key | PXBFMLJZNCDSMP-UHFFFAOYSA-N |
| Molecular Formula | C7H8N2O |
N-Methylhippuric acid, 99%, Thermo Scientific™
CAS: 2568-34-5 Molecular Formula: C10H11NO3 Molecular Weight (g/mol): 193.20 MDL Number: MFCD00144940 InChI Key: PKCSYDDSNIJRIX-UHFFFAOYSA-N Synonym: benzoylsarcosine,n-methylhippuric acid,n-benzoyl-n-methylglycine,n-benzoylsarcosine,glycine, n-benzoyl-n-methyl,2-n-methylbenzamido acetic acid,sarcosine, n-benzoyl,2-benzoyl methyl amino acetic acid,chembl66391,2-n-methyl-1-phenylformamido acetic acid PubChem CID: 75728 IUPAC Name: 2-[benzoyl(methyl)amino]acetic acid SMILES: CN(CC(O)=O)C(=O)C1=CC=CC=C1
| PubChem CID | 75728 |
|---|---|
| CAS | 2568-34-5 |
| Molecular Weight (g/mol) | 193.20 |
| MDL Number | MFCD00144940 |
| SMILES | CN(CC(O)=O)C(=O)C1=CC=CC=C1 |
| Synonym | benzoylsarcosine,n-methylhippuric acid,n-benzoyl-n-methylglycine,n-benzoylsarcosine,glycine, n-benzoyl-n-methyl,2-n-methylbenzamido acetic acid,sarcosine, n-benzoyl,2-benzoyl methyl amino acetic acid,chembl66391,2-n-methyl-1-phenylformamido acetic acid |
| IUPAC Name | 2-[benzoyl(methyl)amino]acetic acid |
| InChI Key | PKCSYDDSNIJRIX-UHFFFAOYSA-N |
| Molecular Formula | C10H11NO3 |
2-Isopropylphenyl isothiocyanate, ≥95%, Thermo Scientific™
CAS: 36176-31-5 Molecular Formula: C10H11NS Molecular Weight (g/mol): 177.265 MDL Number: MFCD00022053 InChI Key: QQOOMDSEMQHMIR-UHFFFAOYSA-N Synonym: 2-isopropylphenyl isothiocyanate,1-isopropyl-2-isothiocyanatobenzene,1-isothiocyanato-2-propan-2-yl benzene,benzene, 1-isothiocyanato-2-1-methylethyl,2-methylethyl benzenisothiocyanate,2-isopropylphenylisothiocyanate,acmc-20ansf,2-isopropylphenyl-isothiocyanate,2-iso-propylphenyl isothiocyanate PubChem CID: 142052 IUPAC Name: 1-isothiocyanato-2-propan-2-ylbenzene SMILES: CC(C)C1=CC=CC=C1N=C=S
| PubChem CID | 142052 |
|---|---|
| CAS | 36176-31-5 |
| Molecular Weight (g/mol) | 177.265 |
| MDL Number | MFCD00022053 |
| SMILES | CC(C)C1=CC=CC=C1N=C=S |
| Synonym | 2-isopropylphenyl isothiocyanate,1-isopropyl-2-isothiocyanatobenzene,1-isothiocyanato-2-propan-2-yl benzene,benzene, 1-isothiocyanato-2-1-methylethyl,2-methylethyl benzenisothiocyanate,2-isopropylphenylisothiocyanate,acmc-20ansf,2-isopropylphenyl-isothiocyanate,2-iso-propylphenyl isothiocyanate |
| IUPAC Name | 1-isothiocyanato-2-propan-2-ylbenzene |
| InChI Key | QQOOMDSEMQHMIR-UHFFFAOYSA-N |
| Molecular Formula | C10H11NS |
4-Isopropylphenol, 98%
CAS: 99-89-8 Molecular Formula: C9H12O Molecular Weight (g/mol): 136.194 MDL Number: MFCD00002372 InChI Key: YQUQWHNMBPIWGK-UHFFFAOYSA-N Synonym: 4-isopropylphenol,p-isopropylphenol,p-cumenol,australol,phenol, 4-1-methylethyl,4-1-methylethyl phenol,1-hydroxy-4-isopropylbenzene,4-propan-2-yl phenol,phenol, p-isopropyl,para-isopropylphenol PubChem CID: 7465 IUPAC Name: 4-propan-2-ylphenol SMILES: CC(C)C1=CC=C(C=C1)O
| PubChem CID | 7465 |
|---|---|
| CAS | 99-89-8 |
| Molecular Weight (g/mol) | 136.194 |
| MDL Number | MFCD00002372 |
| SMILES | CC(C)C1=CC=C(C=C1)O |
| Synonym | 4-isopropylphenol,p-isopropylphenol,p-cumenol,australol,phenol, 4-1-methylethyl,4-1-methylethyl phenol,1-hydroxy-4-isopropylbenzene,4-propan-2-yl phenol,phenol, p-isopropyl,para-isopropylphenol |
| IUPAC Name | 4-propan-2-ylphenol |
| InChI Key | YQUQWHNMBPIWGK-UHFFFAOYSA-N |
| Molecular Formula | C9H12O |
2,6-Diisopropyl-N,N-dimethylaniline, 96%
CAS: 2909-77-5 Molecular Formula: C14H23N Molecular Weight (g/mol): 205.345 MDL Number: MFCD00144978 InChI Key: ALXIOUGHHXXLKX-UHFFFAOYSA-N Synonym: 2,6-diisopropyl-n,n-dimethylaniline,n,n-dimethyl-2,6-diisopropylaniline,benzenamine, n,n-dimethyl-2,6-bis 1-methylethyl,2,6-diisopropyl-n,n-dimethyl-aniline,acmc-20ao8g,2,6-bis methylethyl phenyl dimethylamine,n,n-dimethyl-2,6-di propan-2-yl aniline,benzenamine,n,n-dimethyl-2,6-bis 1-methylethyl PubChem CID: 76198 IUPAC Name: N,N-dimethyl-2,6-di(propan-2-yl)aniline SMILES: CC(C)C1=C(C(=CC=C1)C(C)C)N(C)C
| PubChem CID | 76198 |
|---|---|
| CAS | 2909-77-5 |
| Molecular Weight (g/mol) | 205.345 |
| MDL Number | MFCD00144978 |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)N(C)C |
| Synonym | 2,6-diisopropyl-n,n-dimethylaniline,n,n-dimethyl-2,6-diisopropylaniline,benzenamine, n,n-dimethyl-2,6-bis 1-methylethyl,2,6-diisopropyl-n,n-dimethyl-aniline,acmc-20ao8g,2,6-bis methylethyl phenyl dimethylamine,n,n-dimethyl-2,6-di propan-2-yl aniline,benzenamine,n,n-dimethyl-2,6-bis 1-methylethyl |
| IUPAC Name | N,N-dimethyl-2,6-di(propan-2-yl)aniline |
| InChI Key | ALXIOUGHHXXLKX-UHFFFAOYSA-N |
| Molecular Formula | C14H23N |
2,6-Diisopropylaniline, 90+%
CAS: 24544-04-5 Molecular Formula: C12H19N Molecular Weight (g/mol): 177.29 MDL Number: MFCD00008887 InChI Key: WKBALTUBRZPIPZ-UHFFFAOYSA-N Synonym: 2,6-diisopropylaniline,benzenamine, 2,6-bis 1-methylethyl,2,6-diisopropyl aniline,aniline, 2,6-diisopropyl,diisopropylaniline,2,6-diisopropylphenylamine,2,6-bis propan-2-yl aniline,2,6-dilsopropylaniline,2,6-di propan-2-yl aniline,2,6-bis 1-methylethyl aniline PubChem CID: 32484 IUPAC Name: 2,6-di(propan-2-yl)aniline SMILES: CC(C)C1=C(C(=CC=C1)C(C)C)N
| PubChem CID | 32484 |
|---|---|
| CAS | 24544-04-5 |
| Molecular Weight (g/mol) | 177.29 |
| MDL Number | MFCD00008887 |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)N |
| Synonym | 2,6-diisopropylaniline,benzenamine, 2,6-bis 1-methylethyl,2,6-diisopropyl aniline,aniline, 2,6-diisopropyl,diisopropylaniline,2,6-diisopropylphenylamine,2,6-bis propan-2-yl aniline,2,6-dilsopropylaniline,2,6-di propan-2-yl aniline,2,6-bis 1-methylethyl aniline |
| IUPAC Name | 2,6-di(propan-2-yl)aniline |
| InChI Key | WKBALTUBRZPIPZ-UHFFFAOYSA-N |
| Molecular Formula | C12H19N |
2-Methylphenoxyacetic acid, 98%
CAS: 1878-49-5 Molecular Formula: C9H10O3 Molecular Weight (g/mol): 166.176 MDL Number: MFCD00014354 InChI Key: QJVXBRUGKLCUMY-UHFFFAOYSA-N Synonym: 2-methylphenoxy acetic acid,2-2-methylphenoxy acetic acid,2-methylphenoxyacetic acid,acetic acid, 2-methylphenoxy,o-tolyloxyacetic acid,o-tolyloxy acetic acid,2-o-tolyloxy acetic acid,acetic acid, o-tolyloxy,acide o-methylphenoxyacetique,unii-pxo85n85g3 PubChem CID: 74651 IUPAC Name: 2-(2-methylphenoxy)acetic acid SMILES: CC1=CC=CC=C1OCC(=O)O
| PubChem CID | 74651 |
|---|---|
| CAS | 1878-49-5 |
| Molecular Weight (g/mol) | 166.176 |
| MDL Number | MFCD00014354 |
| SMILES | CC1=CC=CC=C1OCC(=O)O |
| Synonym | 2-methylphenoxy acetic acid,2-2-methylphenoxy acetic acid,2-methylphenoxyacetic acid,acetic acid, 2-methylphenoxy,o-tolyloxyacetic acid,o-tolyloxy acetic acid,2-o-tolyloxy acetic acid,acetic acid, o-tolyloxy,acide o-methylphenoxyacetique,unii-pxo85n85g3 |
| IUPAC Name | 2-(2-methylphenoxy)acetic acid |
| InChI Key | QJVXBRUGKLCUMY-UHFFFAOYSA-N |
| Molecular Formula | C9H10O3 |